C30H32FN5O5S — CID 142797101
3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-2,4-bis(oxan-4-ylamino)benzamide (PubChem CID 142797101) has the molecular formula C30H32FN5O5S and a molecular weight of 593.68 g/mol. Its IUPAC name is 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-2,4-bis(oxan-4-ylamino)benzamide.
| Compound Name | 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-2,4-bis(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 142797101 |
| Molecular Formula | C30H32FN5O5S |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-2,4-bis(oxan-4-ylamino)benzamide |
| SMILES | NC(=O)c1ccc(NC2CCOCC2)c(-c2n[nH]c3ccc(S(=O)(=O)c4cccc(F)c4)cc23)c1NC1CCOCC1 |
| InChI | InChI=1S/C30H32FN5O5S/c31-18-2-1-3-21(16-18)42(38,39)22-4-6-25-24(17-22)29(36-35-25)27-26(33-19-8-12-40-13-9-19)7-5-23(30(32)37)28(27)34-20-10-14-41-15-11-20/h1-7,16-17,19-20,33-34H,8-15H2,(H2,32,37)(H,35,36) |
| InChIKey | JOIFJMWDKGPOAL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |