C15H16BrFN6O3 — CID 142797792
1-[4-[(E)-(3-bromo-4-fluoroanilino)oxyiminomethyl]-1,2,5-oxadiazol-3-yl]piperidine-4-carboxamide (PubChem CID 142797792) has the molecular formula C15H16BrFN6O3 and a molecular weight of 427.23 g/mol. Its IUPAC name is 1-[4-[(E)-(3-bromo-4-fluoroanilino)oxyiminomethyl]-1,2,5-oxadiazol-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(E)-(3-bromo-4-fluoroanilino)oxyiminomethyl]-1,2,5-oxadiazol-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142797792 |
| Molecular Formula | C15H16BrFN6O3 |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1-[4-[(E)-(3-bromo-4-fluoroanilino)oxyiminomethyl]-1,2,5-oxadiazol-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2nonc2/C=N/ONc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C15H16BrFN6O3/c16-11-7-10(1-2-12(11)17)20-25-19-8-13-15(22-26-21-13)23-5-3-9(4-6-23)14(18)24/h1-2,7-9,20H,3-6H2,(H2,18,24)/b19-8+ |
| InChIKey | VEUFORKNJGUAJS-UFWORHAWSA-N |
| XLogP | 2.05 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|