C32H34N2O14P2S — CID 142801235
[2-[[[benzyl(methyl)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-phenoxycarbonyloxyoxolan-3-yl] phenyl carbonate;methanethiol (PubChem CID 142801235) has the molecular formula C32H34N2O14P2S and a molecular weight of 764.64 g/mol. Its IUPAC name is [2-[[[benzyl(methyl)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-phenoxycarbonyloxyoxolan-3-yl] phenyl carbonate;methanethiol.
| Compound Name | [2-[[[benzyl(methyl)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-phenoxycarbonyloxyoxolan-3-yl] phenyl carbonate;methanethiol |
|---|---|
| PubChem CID | 142801235 |
| Molecular Formula | C32H34N2O14P2S |
| Molecular Weight | 764.64 g/mol |
| Exact Mass | 764.12 |
| IUPAC Name | [2-[[[benzyl(methyl)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-phenoxycarbonyloxyoxolan-3-yl] phenyl carbonate;methanethiol |
| SMILES | CP(=O)(Cc1ccccc1)OP(=O)(O)OCC1OC(n2ccc(=O)[nH]c2=O)C(OC(=O)Oc2ccccc2)C1OC(=O)Oc1ccccc1.CS |
| InChI | InChI=1S/C31H30N2O14P2.CH4S/c1-48(38,20-21-11-5-2-6-12-21)47-49(39,40)41-19-24-26(45-30(36)42-22-13-7-3-8-14-22)27(46-31(37)43-23-15-9-4-10-16-23)28(44-24)33-18-17-25(34)32-29(33)35;1-2/h2-18,24,26-28H,19-20H2,1H3,(H,39,40)(H,32,34,35);2H,1H3 |
| InChIKey | FOHADUXFLMJPTP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 207.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|