C27H24N2O14P2-2 — CID 58989323
[[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-phenoxycarbonyloxyoxolan-2-yl]methoxy-oxidophosphoryl] naphthalen-2-ylmethyl phosphate (PubChem CID 58989323) has the molecular formula C27H24N2O14P2-2 and a molecular weight of 662.44 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-phenoxycarbonyloxyoxolan-2-yl]methoxy-oxidophosphoryl] naphthalen-2-ylmethyl phosphate.
| Compound Name | [[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-phenoxycarbonyloxyoxolan-2-yl]methoxy-oxidophosphoryl] naphthalen-2-ylmethyl phosphate |
|---|---|
| PubChem CID | 58989323 |
| Molecular Formula | C27H24N2O14P2-2 |
| Molecular Weight | 662.44 g/mol |
| Exact Mass | 662.07 |
| IUPAC Name | [[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-phenoxycarbonyloxyoxolan-2-yl]methoxy-oxidophosphoryl] naphthalen-2-ylmethyl phosphate |
| SMILES | O=C(Oc1ccccc1)OC1[C@@H](COP(=O)([O-])OP(=O)([O-])OCc2ccc3ccccc3c2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H]1O |
| InChI | InChI=1S/C27H26N2O14P2/c30-22-12-13-29(26(32)28-22)25-23(31)24(42-27(33)40-20-8-2-1-3-9-20)21(41-25)16-39-45(36,37)43-44(34,35)38-15-17-10-11-18-6-4-5-7-19(18)14-17/h1-14,21,23-25,31H,15-16H2,(H,34,35)(H,36,37)(H,28,30,32)/p-2/t21-,23+,24?,25-/m1/s1 |
| InChIKey | OBJYCNZDQBLEAQ-AMXQZFSZSA-L |
| XLogP | 1.72 |
| TPSA | 227.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|