C15H16N2O12P2-2 — CID 25203283
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phenyl phosphate (PubChem CID 25203283) has the molecular formula C15H16N2O12P2-2 and a molecular weight of 478.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phenyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phenyl phosphate |
|---|---|
| PubChem CID | 25203283 |
| Molecular Formula | C15H16N2O12P2-2 |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phenyl phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])Oc3ccccc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H18N2O12P2/c18-11-6-7-17(15(21)16-11)14-13(20)12(19)10(27-14)8-26-30(22,23)29-31(24,25)28-9-4-2-1-3-5-9/h1-7,10,12-14,19-20H,8H2,(H,22,23)(H,24,25)(H,16,18,21)/p-2/t10-,12-,13-,14-/m1/s1 |
| InChIKey | ZHUWBKDWWGKIEN-FMKGYKFTSA-L |
| XLogP | -1.80 |
| TPSA | 212.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|