C17H30N3O12P2- — CID 59226660
[8-azaniumyloctoxy(oxido)phosphoryl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 59226660) has the molecular formula C17H30N3O12P2- and a molecular weight of 530.38 g/mol. Its IUPAC name is [8-azaniumyloctoxy(oxido)phosphoryl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [8-azaniumyloctoxy(oxido)phosphoryl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 59226660 |
| Molecular Formula | C17H30N3O12P2- |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | [8-azaniumyloctoxy(oxido)phosphoryl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | [NH3+]CCCCCCCCOP(=O)([O-])OP(=O)([O-])OCC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C17H31N3O12P2/c18-8-5-3-1-2-4-6-10-29-33(25,26)32-34(27,28)30-11-12-14(22)15(23)16(31-12)20-9-7-13(21)19-17(20)24/h7,9,12,14-16,22-23H,1-6,8,10-11,18H2,(H,25,26)(H,27,28)(H,19,21,24)/p-1 |
| InChIKey | GITVFCBBDYKKDW-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 240.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|