C15H15ClN2O12P2-2 — CID 91933960
[(3-chlorophenoxy)-oxidophosphoryl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 91933960) has the molecular formula C15H15ClN2O12P2-2 and a molecular weight of 512.69 g/mol. Its IUPAC name is [(3-chlorophenoxy)-oxidophosphoryl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [(3-chlorophenoxy)-oxidophosphoryl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 91933960 |
| Molecular Formula | C15H15ClN2O12P2-2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | [(3-chlorophenoxy)-oxidophosphoryl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])Oc3cccc(Cl)c3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17ClN2O12P2/c16-8-2-1-3-9(6-8)29-32(25,26)30-31(23,24)27-7-10-12(20)13(21)14(28-10)18-5-4-11(19)17-15(18)22/h1-6,10,12-14,20-21H,7H2,(H,23,24)(H,25,26)(H,17,19,22)/p-2/t10-,12-,13-,14-/m1/s1 |
| InChIKey | AGGOCBBDZCKITM-FMKGYKFTSA-L |
| XLogP | -1.14 |
| TPSA | 212.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|