C15H25N3 — CID 142801251
(Z)-4,4-dimethyl-1-[4-methyl-N-(methylamino)anilino]pent-1-en-1-amine (PubChem CID 142801251) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (Z)-4,4-dimethyl-1-[4-methyl-N-(methylamino)anilino]pent-1-en-1-amine.
| Compound Name | (Z)-4,4-dimethyl-1-[4-methyl-N-(methylamino)anilino]pent-1-en-1-amine |
|---|---|
| PubChem CID | 142801251 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (Z)-4,4-dimethyl-1-[4-methyl-N-(methylamino)anilino]pent-1-en-1-amine |
| SMILES | CNN(/C(N)=C\CC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25N3/c1-12-6-8-13(9-7-12)18(17-5)14(16)10-11-15(2,3)4/h6-10,17H,11,16H2,1-5H3/b14-10- |
| InChIKey | CECICWQLPLCTRS-UVTDQMKNSA-N |
| XLogP | 3.17 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|