C20H19N3O5 — CID 142803501
(4E)-1-(3,4-dihydroxyphenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 142803501) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (4E)-1-(3,4-dihydroxyphenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4E)-1-(3,4-dihydroxyphenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 142803501 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4E)-1-(3,4-dihydroxyphenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(O)c(O)c2)C(=O)/C1=C/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H19N3O5/c24-17-6-5-15(12-18(17)25)23-20(27)16(19(26)21-23)11-13-1-3-14(4-2-13)22-7-9-28-10-8-22/h1-6,11-12,24-25H,7-10H2,(H,21,26)/b16-11+ |
| InChIKey | SBHDHURAECFACD-LFIBNONCSA-N |
| XLogP | 1.40 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|