C14H18FNO2 — CID 142806562
cyclopropyl-[4-[3-fluoro-1-hydroxy-2-(methylamino)propyl]phenyl]methanone (PubChem CID 142806562) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is cyclopropyl-[4-[3-fluoro-1-hydroxy-2-(methylamino)propyl]phenyl]methanone.
| Compound Name | cyclopropyl-[4-[3-fluoro-1-hydroxy-2-(methylamino)propyl]phenyl]methanone |
|---|---|
| PubChem CID | 142806562 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | cyclopropyl-[4-[3-fluoro-1-hydroxy-2-(methylamino)propyl]phenyl]methanone |
| SMILES | CNC(CF)C(O)c1ccc(C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C14H18FNO2/c1-16-12(8-15)14(18)11-6-4-10(5-7-11)13(17)9-2-3-9/h4-7,9,12,14,16,18H,2-3,8H2,1H3 |
| InChIKey | WZEHIGJUGGKSET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |