C10H8N2O3S — CID 142807728
methyl 8-hydroxy-5-sulfanylidene-6H-1,6-naphthyridine-7-carboxylate (PubChem CID 142807728) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is methyl 8-hydroxy-5-sulfanylidene-6H-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 8-hydroxy-5-sulfanylidene-6H-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 142807728 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | methyl 8-hydroxy-5-sulfanylidene-6H-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1[nH]c(=S)c2cccnc2c1O |
| InChI | InChI=1S/C10H8N2O3S/c1-15-10(14)7-8(13)6-5(9(16)12-7)3-2-4-11-6/h2-4,13H,1H3,(H,12,16) |
| InChIKey | ORLWKGAAONXPBJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|