C24H25FO2 — CID 142808724
4-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one (PubChem CID 142808724) has the molecular formula C24H25FO2 and a molecular weight of 364.46 g/mol. Its IUPAC name is 4-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one.
| Compound Name | 4-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142808724 |
| Molecular Formula | C24H25FO2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one |
| SMILES | CC1C(=O)C(c2ccc(F)cc2)=C(c2ccccc2)C1(O)C1CCCCC1 |
| InChI | InChI=1S/C24H25FO2/c1-16-23(26)21(17-12-14-20(25)15-13-17)22(18-8-4-2-5-9-18)24(16,27)19-10-6-3-7-11-19/h2,4-5,8-9,12-16,19,27H,3,6-7,10-11H2,1H3 |
| InChIKey | DLSOVALYWHVBMT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|