C26H48O — CID 142809052
(2E)-2-heptylidene-7-methyl-3a,4,7,7a-tetrahydro-3H-inden-1-one;hexane;propane (PubChem CID 142809052) has the molecular formula C26H48O and a molecular weight of 376.67 g/mol. Its IUPAC name is (2E)-2-heptylidene-7-methyl-3a,4,7,7a-tetrahydro-3H-inden-1-one;hexane;propane.
| Compound Name | (2E)-2-heptylidene-7-methyl-3a,4,7,7a-tetrahydro-3H-inden-1-one;hexane;propane |
|---|---|
| PubChem CID | 142809052 |
| Molecular Formula | C26H48O |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.37 |
| IUPAC Name | (2E)-2-heptylidene-7-methyl-3a,4,7,7a-tetrahydro-3H-inden-1-one;hexane;propane |
| SMILES | CCC.CCCCCC.CCCCCC/C=C1\CC2CC=CC(C)C2C1=O |
| InChI | InChI=1S/C17H26O.C6H14.C3H8/c1-3-4-5-6-7-10-15-12-14-11-8-9-13(2)16(14)17(15)18;1-3-5-6-4-2;1-3-2/h8-10,13-14,16H,3-7,11-12H2,1-2H3;3-6H2,1-2H3;3H2,1-2H3/b15-10+;; |
| InChIKey | SDVHQMGKFWEMIM-OVWKBUNZSA-N |
| XLogP | 8.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|