C18H27FN2O4 — CID 142809875
N-[(2E,4E,6E)-2-fluoro-6-nitronona-2,4,6-trien-5-yl]-2-(3-methylcyclohexyl)oxyacetamide (PubChem CID 142809875) has the molecular formula C18H27FN2O4 and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[(2E,4E,6E)-2-fluoro-6-nitronona-2,4,6-trien-5-yl]-2-(3-methylcyclohexyl)oxyacetamide.
| Compound Name | N-[(2E,4E,6E)-2-fluoro-6-nitronona-2,4,6-trien-5-yl]-2-(3-methylcyclohexyl)oxyacetamide |
|---|---|
| PubChem CID | 142809875 |
| Molecular Formula | C18H27FN2O4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N-[(2E,4E,6E)-2-fluoro-6-nitronona-2,4,6-trien-5-yl]-2-(3-methylcyclohexyl)oxyacetamide |
| SMILES | CC/C=C(C(=C/C=C(\C)F)\NC(=O)COC1CCCC(C)C1)/[N+](=O)[O-] |
| InChI | InChI=1S/C18H27FN2O4/c1-4-6-17(21(23)24)16(10-9-14(3)19)20-18(22)12-25-15-8-5-7-13(2)11-15/h6,9-10,13,15H,4-5,7-8,11-12H2,1-3H3,(H,20,22)/b14-9+,16-10+,17-6+ |
| InChIKey | YBYXRUZMRZQXRJ-VISRDNKZSA-N |
| XLogP | 4.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|