About 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol
2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol (PubChem CID 142810343) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol.
Analyze 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol?
The IUPAC name of 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol (CID 142810343) is 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol.
What is the SMILES notation for 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol?
The canonical SMILES for 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol is CNC1=CC=CC(C)=C(O)C1.
What is the InChIKey of 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol?
The InChIKey is IWRDFNRRYIAHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-4-3-5-8(10-2)6-9(7)11/h3-5,10-11H,6H2,1-2H3.
What are the key properties of 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol?
2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol has a molecular weight of 151.21 g/mol, XLogP of 1.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-ol is sourced from PubChem (CID 142810343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).