C17H24NO+ — CID 145341600
[(2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-yl]oxidanium (PubChem CID 145341600) has the molecular formula C17H24NO+ and a molecular weight of 258.38 g/mol. Its IUPAC name is [(2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-yl]oxidanium.
| Compound Name | [(2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-yl]oxidanium |
|---|---|
| PubChem CID | 145341600 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | [(2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-yl]oxidanium |
| SMILES | CC/C=C(\C=C(\C)[OH2+])/C=C/C1=CC=C(NC)C=CC1 |
| InChI | InChI=1S/C17H23NO/c1-4-6-16(13-14(2)19)10-9-15-7-5-8-17(18-3)12-11-15/h5-6,8-13,18-19H,4,7H2,1-3H3/p+1/b10-9+,14-13-,16-6- |
| InChIKey | YFCSVJXLXDQEDX-CBTZVKGASA-O |
| XLogP | 3.50 |
| TPSA | 34.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|