C23H42F2O4 — CID 142810527
ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-ol;(1-methylcyclopropyl)-(2-methyl-2,3-dihydrofuran-5-yl)methanol (PubChem CID 142810527) has the molecular formula C23H42F2O4 and a molecular weight of 420.58 g/mol. Its IUPAC name is ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-ol;(1-methylcyclopropyl)-(2-methyl-2,3-dihydrofuran-5-yl)methanol.
| Compound Name | ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-ol;(1-methylcyclopropyl)-(2-methyl-2,3-dihydrofuran-5-yl)methanol |
|---|---|
| PubChem CID | 142810527 |
| Molecular Formula | C23H42F2O4 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-ol;(1-methylcyclopropyl)-(2-methyl-2,3-dihydrofuran-5-yl)methanol |
| SMILES | C=CC(F)(F)C(O)/C(=C/C)OCC.CC.CC.CC1CC=C(C(O)C2(C)CC2)O1 |
| InChI | InChI=1S/C10H16O2.C9H14F2O2.2C2H6/c1-7-3-4-8(12-7)9(11)10(2)5-6-10;1-4-7(13-6-3)8(12)9(10,11)5-2;2*1-2/h4,7,9,11H,3,5-6H2,1-2H3;4-5,8,12H,2,6H2,1,3H3;2*1-2H3/b;7-4-;; |
| InChIKey | SZRNMDRIRGKVID-ODLRMCOUSA-N |
| XLogP | 6.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|