C22H45FO4 — CID 142810509
(Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol;2-fluoropropane;(Z)-2-propan-2-yloxybut-2-en-1-ol (PubChem CID 142810509) has the molecular formula C22H45FO4 and a molecular weight of 392.60 g/mol. Its IUPAC name is (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol;2-fluoropropane;(Z)-2-propan-2-yloxybut-2-en-1-ol.
| Compound Name | (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol;2-fluoropropane;(Z)-2-propan-2-yloxybut-2-en-1-ol |
|---|---|
| PubChem CID | 142810509 |
| Molecular Formula | C22H45FO4 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol;2-fluoropropane;(Z)-2-propan-2-yloxybut-2-en-1-ol |
| SMILES | C/C=C(/CO)OC(C)C.C/C=C(\OCCC)C(O)CC(C)(C)C.CC(C)F |
| InChI | InChI=1S/C12H24O2.C7H14O2.C3H7F/c1-6-8-14-11(7-2)10(13)9-12(3,4)5;1-4-7(5-8)9-6(2)3;1-3(2)4/h7,10,13H,6,8-9H2,1-5H3;4,6,8H,5H2,1-3H3;3H,1-2H3/b11-7-;7-4-; |
| InChIKey | KPRZMCZEBUEQMB-LLYOQGRDSA-N |
| XLogP | 5.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|