C32H35N4O4S2+ — CID 142811488
CID 142811488 (PubChem CID 142811488) has the molecular formula C32H35N4O4S2+ and a molecular weight of 603.79 g/mol.
| Compound Name | CID 142811488 |
|---|---|
| PubChem CID | 142811488 |
| Molecular Formula | C32H35N4O4S2+ |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | — |
| SMILES | CN(C)CCOc1ccc([C@H](NC(=O)C2NC(c3cc(-c4ccccc4)ccc3[SH+](=O)O)CS2)c2ccccc2)nc1 |
| InChI | InChI=1S/C32H34N4O4S2/c1-36(2)17-18-40-25-14-15-27(33-20-25)30(23-11-7-4-8-12-23)35-31(37)32-34-28(21-41-32)26-19-24(13-16-29(26)42(38)39)22-9-5-3-6-10-22/h3-16,19-20,28,30,32,34H,17-18,21H2,1-2H3,(H,35,37)(H,38,39)/p+1/t28?,30-,32?/m1/s1 |
| InChIKey | WTQXSNUWYMEPJD-VJMBWVNKSA-O |
| XLogP | 4.83 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|