C19H22ClN3O3S — CID 1428119
N-[4-[(4-chlorophenyl)carbamothioylamino]-2,5-diethoxyphenyl]acetamide (PubChem CID 1428119) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.90 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)carbamothioylamino]-2,5-diethoxyphenyl]acetamide.
| Compound Name | N-[4-[(4-chlorophenyl)carbamothioylamino]-2,5-diethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 1428119 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[4-[(4-chlorophenyl)carbamothioylamino]-2,5-diethoxyphenyl]acetamide |
| SMILES | CCOC1=CC(=C(C=C1NC(=O)C)OCC)NC(=S)NC2=CC=C(C=C2)Cl |
| InChI | InChI=1S/C19H22ClN3O3S/c1-4-25-17-11-16(18(26-5-2)10-15(17)21-12(3)24)23-19(27)22-14-8-6-13(20)7-9-14/h6-11H,4-5H2,1-3H3,(H,21,24)(H2,22,23,27) |
| InChIKey | WAQFACWAKXCGNR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | 489 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|