C22H29N3O4S — CID 1172440
N-[2,5-diethoxy-4-[(3-methoxyphenyl)carbamothioylamino]phenyl]-2-methylpropanamide (PubChem CID 1172440) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[(3-methoxyphenyl)carbamothioylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[2,5-diethoxy-4-[(3-methoxyphenyl)carbamothioylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1172440 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[2,5-diethoxy-4-[(3-methoxyphenyl)carbamothioylamino]phenyl]-2-methylpropanamide |
| SMILES | CCOc1cc(NC(=S)Nc2cccc(OC)c2)c(OCC)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C22H29N3O4S/c1-6-28-19-13-18(20(29-7-2)12-17(19)24-21(26)14(3)4)25-22(30)23-15-9-8-10-16(11-15)27-5/h8-14H,6-7H2,1-5H3,(H,24,26)(H2,23,25,30) |
| InChIKey | RUAXHSUPXFCPIE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|