C20H22ClN3O3S — CID 21213503
3-chloro-4-ethoxy-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 21213503) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21213503 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)C(C)C)c2)cc1Cl |
| InChI | InChI=1S/C20H22ClN3O3S/c1-4-27-17-9-8-13(10-16(17)21)19(26)24-20(28)23-15-7-5-6-14(11-15)22-18(25)12(2)3/h5-12H,4H2,1-3H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | OUDMCTLIXKVXOP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|