C23H24ClFN2O4 — CID 14281491
4-[4-ethynyl-4-(2-nitrophenoxy)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride (PubChem CID 14281491) has the molecular formula C23H24ClFN2O4 and a molecular weight of 446.91 g/mol. Its IUPAC name is 4-[4-ethynyl-4-(2-nitrophenoxy)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride.
| Compound Name | 4-[4-ethynyl-4-(2-nitrophenoxy)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 14281491 |
| Molecular Formula | C23H24ClFN2O4 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[4-ethynyl-4-(2-nitrophenoxy)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
| SMILES | C#CC1(Oc2ccccc2[N+](=O)[O-])CCN(CCCC(=O)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C23H23FN2O4.ClH/c1-2-23(30-22-8-4-3-6-20(22)26(28)29)13-16-25(17-14-23)15-5-7-21(27)18-9-11-19(24)12-10-18;/h1,3-4,6,8-12H,5,7,13-17H2;1H |
| InChIKey | KHOFJJKROYBHPO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|