C35H39F4N3O3 — CID 142814990
N'-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)but-3-enyl]amino]-1-(3-propan-2-ylphenyl)prop-1-enyl]-N,N-dimethylbenzenecarboximidamide (PubChem CID 142814990) has the molecular formula C35H39F4N3O3 and a molecular weight of 625.71 g/mol. Its IUPAC name is N'-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)but-3-enyl]amino]-1-(3-propan-2-ylphenyl)prop-1-enyl]-N,N-dimethylbenzenecarboximidamide.
| Compound Name | N'-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)but-3-enyl]amino]-1-(3-propan-2-ylphenyl)prop-1-enyl]-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142814990 |
| Molecular Formula | C35H39F4N3O3 |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | N'-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)but-3-enyl]amino]-1-(3-propan-2-ylphenyl)prop-1-enyl]-N,N-dimethylbenzenecarboximidamide |
| SMILES | CC(C)c1cccc(C(=C\CN(CC/C=C/OC(F)(F)C(F)F)Cc2ccc3c(c2)OCO3)/N=C(/c2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C35H39F4N3O3/c1-25(2)28-13-10-14-29(22-28)30(40-33(41(3)4)27-11-6-5-7-12-27)17-19-42(18-8-9-20-45-35(38,39)34(36)37)23-26-15-16-31-32(21-26)44-24-43-31/h5-7,9-17,20-22,25,34H,8,18-19,23-24H2,1-4H3/b20-9+,30-17+,40-33- |
| InChIKey | AYURNVPZXLCBFS-HJMXWQFOSA-N |
| XLogP | 8.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|