C38H44FN3O3 — CID 142815204
N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(3E,5Z)-4-ethoxyocta-3,5,7-trienyl]amino]-1-(4-fluorophenyl)prop-1-enyl]-N'-butylbenzenecarboximidamide (PubChem CID 142815204) has the molecular formula C38H44FN3O3 and a molecular weight of 609.79 g/mol. Its IUPAC name is N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(3E,5Z)-4-ethoxyocta-3,5,7-trienyl]amino]-1-(4-fluorophenyl)prop-1-enyl]-N'-butylbenzenecarboximidamide.
| Compound Name | N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(3E,5Z)-4-ethoxyocta-3,5,7-trienyl]amino]-1-(4-fluorophenyl)prop-1-enyl]-N'-butylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142815204 |
| Molecular Formula | C38H44FN3O3 |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(3E,5Z)-4-ethoxyocta-3,5,7-trienyl]amino]-1-(4-fluorophenyl)prop-1-enyl]-N'-butylbenzenecarboximidamide |
| SMILES | C=C/C=C\C(=C/CCN(C/C=C(/N/C(=N/CCCC)c1ccccc1)c1ccc(F)cc1)Cc1ccc2c(c1)OCO2)OCC |
| InChI | InChI=1S/C38H44FN3O3/c1-4-7-15-34(43-6-3)16-12-25-42(28-30-17-22-36-37(27-30)45-29-44-36)26-23-35(31-18-20-33(39)21-19-31)41-38(40-24-8-5-2)32-13-10-9-11-14-32/h4,7,9-11,13-23,27H,1,5-6,8,12,24-26,28-29H2,2-3H3,(H,40,41)/b15-7-,34-16+,35-23+ |
| InChIKey | IKTUDUBCWYBYPN-VOUADPKGSA-N |
| XLogP | 8.29 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|