C17H18FN5O2 — CID 67370578
2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-[(4-fluorophenyl)methyl]guanidine (PubChem CID 67370578) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-[(4-fluorophenyl)methyl]guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-[(4-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 67370578 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-[(4-fluorophenyl)methyl]guanidine |
| SMILES | NC(N)=N/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN5O2/c18-13-4-1-11(2-5-13)8-21-17(23-16(19)20)22-9-12-3-6-14-15(7-12)25-10-24-14/h1-7H,8-10H2,(H5,19,20,21,22,23) |
| InChIKey | DLUDLKLQNYFFIY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|