C17H17F2N5O2 — CID 67372836
1-(1,3-benzodioxol-5-ylmethyl)-3-(diaminomethylidene)-2-[(3,4-difluorophenyl)methyl]guanidine (PubChem CID 67372836) has the molecular formula C17H17F2N5O2 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(diaminomethylidene)-2-[(3,4-difluorophenyl)methyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(diaminomethylidene)-2-[(3,4-difluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 67372836 |
| Molecular Formula | C17H17F2N5O2 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(diaminomethylidene)-2-[(3,4-difluorophenyl)methyl]guanidine |
| SMILES | NC(N)=N/C(=N/Cc1ccc(F)c(F)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17F2N5O2/c18-12-3-1-10(5-13(12)19)7-22-17(24-16(20)21)23-8-11-2-4-14-15(6-11)26-9-25-14/h1-6H,7-9H2,(H5,20,21,22,23,24) |
| InChIKey | PBTGIYOBCBFOBQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|