C23H21F3N3O2+ — CID 90688959
3-(3,4-dimethoxyphenyl)-4-methyl-8-[[3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyrazin-4-ium (PubChem CID 90688959) has the molecular formula C23H21F3N3O2+ and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-methyl-8-[[3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyrazin-4-ium.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-methyl-8-[[3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 90688959 |
| Molecular Formula | C23H21F3N3O2+ |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-methyl-8-[[3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyrazin-4-ium |
| SMILES | COc1ccc(C2=CN=C3C(Cc4cccc(C(F)(F)F)c4)=NC=C[N+]23C)cc1OC |
| InChI | InChI=1S/C23H21F3N3O2/c1-29-10-9-27-18(12-15-5-4-6-17(11-15)23(24,25)26)22(29)28-14-19(29)16-7-8-20(30-2)21(13-16)31-3/h4-11,13-14H,12H2,1-3H3/q+1 |
| InChIKey | MJNVSICZDIDVMY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|