C34H43N3O4 — CID 142815153
N-[(3-butyl-2-phenylimidazol-4-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-3-(methoxymethoxy)benzamide;ethane (PubChem CID 142815153) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is N-[(3-butyl-2-phenylimidazol-4-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-3-(methoxymethoxy)benzamide;ethane.
| Compound Name | N-[(3-butyl-2-phenylimidazol-4-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-3-(methoxymethoxy)benzamide;ethane |
|---|---|
| PubChem CID | 142815153 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | N-[(3-butyl-2-phenylimidazol-4-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-3-(methoxymethoxy)benzamide;ethane |
| SMILES | CC.CCCCn1c(CN(Cc2ccc(OCC)cc2)C(=O)c2cccc(OCOC)c2)cnc1-c1ccccc1 |
| InChI | InChI=1S/C32H37N3O4.C2H6/c1-4-6-19-35-28(21-33-31(35)26-11-8-7-9-12-26)23-34(22-25-15-17-29(18-16-25)38-5-2)32(36)27-13-10-14-30(20-27)39-24-37-3;1-2/h7-18,20-21H,4-6,19,22-24H2,1-3H3;1-2H3 |
| InChIKey | NPQABDURJMXWOU-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|