C24H29N3O5 — CID 142815758
(2S)-1-[(3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-phenylpyrrolidine-2-carboxamide (PubChem CID 142815758) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142815758 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (2S)-1-[(3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-phenylpyrrolidine-2-carboxamide |
| SMILES | CCC(C(=O)NO)C(C(=O)N1CCC[C@H]1C(=O)Nc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H29N3O5/c1-3-19(22(28)26-31)21(16-11-13-18(32-2)14-12-16)24(30)27-15-7-10-20(27)23(29)25-17-8-5-4-6-9-17/h4-6,8-9,11-14,19-21,31H,3,7,10,15H2,1-2H3,(H,25,29)(H,26,28)/t19?,20-,21?/m0/s1 |
| InChIKey | SUWFGBCOVKQYMJ-KBWCOIMZSA-N |
| XLogP | 2.94 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|