C24H28ClN3O5 — CID 87502378
[(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperidin-2-yl] N-phenylcarbamate (PubChem CID 87502378) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperidin-2-yl] N-phenylcarbamate.
| Compound Name | [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperidin-2-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 87502378 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperidin-2-yl] N-phenylcarbamate |
| SMILES | CC[C@H](C(=O)NO)[C@H](C(=O)N1CCCC[C@@H]1OC(=O)Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClN3O5/c1-2-19(22(29)27-32)21(16-11-13-17(25)14-12-16)23(30)28-15-7-6-10-20(28)33-24(31)26-18-8-4-3-5-9-18/h3-5,8-9,11-14,19-21,32H,2,6-7,10,15H2,1H3,(H,26,31)(H,27,29)/t19-,20-,21+/m0/s1 |
| InChIKey | SJWGWYYETHNOHO-PCCBWWKXSA-N |
| XLogP | 4.54 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|