C21H31ClN4O5 — CID 87503051
[(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperazin-2-yl] N-(2-methylpropyl)carbamate (PubChem CID 87503051) has the molecular formula C21H31ClN4O5 and a molecular weight of 454.96 g/mol. Its IUPAC name is [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperazin-2-yl] N-(2-methylpropyl)carbamate.
| Compound Name | [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperazin-2-yl] N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 87503051 |
| Molecular Formula | C21H31ClN4O5 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(2S)-1-[(2S,3S)-2-(4-chlorophenyl)-3-(hydroxycarbamoyl)pentanoyl]piperazin-2-yl] N-(2-methylpropyl)carbamate |
| SMILES | CC[C@H](C(=O)NO)[C@H](C(=O)N1CCNC[C@@H]1OC(=O)NCC(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H31ClN4O5/c1-4-16(19(27)25-30)18(14-5-7-15(22)8-6-14)20(28)26-10-9-23-12-17(26)31-21(29)24-11-13(2)3/h5-8,13,16-18,23,30H,4,9-12H2,1-3H3,(H,24,29)(H,25,27)/t16-,17-,18+/m0/s1 |
| InChIKey | QWZWCZDGGNLPMW-OKZBNKHCSA-N |
| XLogP | 2.10 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|