C12H19NO2S3 — CID 142816816
3-[bis(sulfanyl)amino]-3-(4-methoxyphenyl)propanethioic S-acid;ethane (PubChem CID 142816816) has the molecular formula C12H19NO2S3 and a molecular weight of 305.49 g/mol. Its IUPAC name is 3-[bis(sulfanyl)amino]-3-(4-methoxyphenyl)propanethioic S-acid;ethane.
| Compound Name | 3-[bis(sulfanyl)amino]-3-(4-methoxyphenyl)propanethioic S-acid;ethane |
|---|---|
| PubChem CID | 142816816 |
| Molecular Formula | C12H19NO2S3 |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-[bis(sulfanyl)amino]-3-(4-methoxyphenyl)propanethioic S-acid;ethane |
| SMILES | CC.COc1ccc(C(CC(=O)S)N(S)S)cc1 |
| InChI | InChI=1S/C10H13NO2S3.C2H6/c1-13-8-4-2-7(3-5-8)9(11(15)16)6-10(12)14;1-2/h2-5,9,15-16H,6H2,1H3,(H,12,14);1-2H3 |
| InChIKey | MURIOQMLPQUYPV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|