About ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde
ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde (PubChem CID 142816956) has the molecular formula C16H28FNO
and a molecular weight of 269.40 g/mol. Its IUPAC name is ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde.
Molecular Properties
| Compound Name | ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde |
| PubChem CID | 142816956 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde |
| SMILES | CC.CCCCCNCC.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H5FO.C7H17N.C2H6/c8-7-3-1-6(5-9)2-4-7;1-3-5-6-7-8-4-2;1-2/h1-5H;8H,3-7H2,1-2H3;1-2H3 |
| InChIKey | OPPUTIIHXAIQPI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde?
The IUPAC name of ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde (CID 142816956) is ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde.
What is the SMILES notation for ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde?
The canonical SMILES for ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde is CC.CCCCCNCC.O=Cc1ccc(F)cc1.
What is the InChIKey of ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde?
The InChIKey is OPPUTIIHXAIQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO.C7H17N.C2H6/c8-7-3-1-6(5-9)2-4-7;1-3-5-6-7-8-4-2;1-2/h1-5H;8H,3-7H2,1-2H3;1-2H3.
What are the key properties of ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde?
ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde has a molecular weight of 269.40 g/mol, XLogP of 4.45, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethylpentan-1-amine;4-fluorobenzaldehyde is sourced from PubChem (CID 142816956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).