C43H45BrN2O3 — CID 142818324
5-[3-[(4-bromo-N-[1-[[3-(3-ethenyl-5-methoxyphenyl)phenyl]methyl]piperidin-4-yl]anilino)methyl]phenyl]-3-propylbenzene-1,2-diol (PubChem CID 142818324) has the molecular formula C43H45BrN2O3 and a molecular weight of 717.75 g/mol. Its IUPAC name is 5-[3-[(4-bromo-N-[1-[[3-(3-ethenyl-5-methoxyphenyl)phenyl]methyl]piperidin-4-yl]anilino)methyl]phenyl]-3-propylbenzene-1,2-diol.
| Compound Name | 5-[3-[(4-bromo-N-[1-[[3-(3-ethenyl-5-methoxyphenyl)phenyl]methyl]piperidin-4-yl]anilino)methyl]phenyl]-3-propylbenzene-1,2-diol |
|---|---|
| PubChem CID | 142818324 |
| Molecular Formula | C43H45BrN2O3 |
| Molecular Weight | 717.75 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 5-[3-[(4-bromo-N-[1-[[3-(3-ethenyl-5-methoxyphenyl)phenyl]methyl]piperidin-4-yl]anilino)methyl]phenyl]-3-propylbenzene-1,2-diol |
| SMILES | C=Cc1cc(OC)cc(-c2cccc(CN3CCC(N(Cc4cccc(-c5cc(O)c(O)c(CCC)c5)c4)c4ccc(Br)cc4)CC3)c2)c1 |
| InChI | InChI=1S/C43H45BrN2O3/c1-4-8-35-25-37(27-42(47)43(35)48)34-12-7-10-32(23-34)29-46(39-15-13-38(44)14-16-39)40-17-19-45(20-18-40)28-31-9-6-11-33(22-31)36-21-30(5-2)24-41(26-36)49-3/h5-7,9-16,21-27,40,47-48H,2,4,8,17-20,28-29H2,1,3H3 |
| InChIKey | NWIGCPHKWICDGY-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.75 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|