C47H55FN2O4 — CID 142906090
N,1-bis[[3-(3,4-dimethoxy-5-propylphenyl)phenyl]methyl]-N-(4-fluorophenyl)piperidin-4-amine (PubChem CID 142906090) has the molecular formula C47H55FN2O4 and a molecular weight of 730.96 g/mol. Its IUPAC name is N,1-bis[[3-(3,4-dimethoxy-5-propylphenyl)phenyl]methyl]-N-(4-fluorophenyl)piperidin-4-amine.
| Compound Name | N,1-bis[[3-(3,4-dimethoxy-5-propylphenyl)phenyl]methyl]-N-(4-fluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 142906090 |
| Molecular Formula | C47H55FN2O4 |
| Molecular Weight | 730.96 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | N,1-bis[[3-(3,4-dimethoxy-5-propylphenyl)phenyl]methyl]-N-(4-fluorophenyl)piperidin-4-amine |
| SMILES | CCCc1cc(-c2cccc(CN3CCC(N(Cc4cccc(-c5cc(CCC)c(OC)c(OC)c5)c4)c4ccc(F)cc4)CC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C47H55FN2O4/c1-7-11-37-27-39(29-44(51-3)46(37)53-5)35-15-9-13-33(25-35)31-49-23-21-43(22-24-49)50(42-19-17-41(48)18-20-42)32-34-14-10-16-36(26-34)40-28-38(12-8-2)47(54-6)45(30-40)52-4/h9-10,13-20,25-30,43H,7-8,11-12,21-24,31-32H2,1-6H3 |
| InChIKey | GCMBICUYXZHLBR-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.96 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |