C43H47BrN2O6 — CID 18174190
N-(4-bromophenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine (PubChem CID 18174190) has the molecular formula C43H47BrN2O6 and a molecular weight of 767.76 g/mol. Its IUPAC name is N-(4-bromophenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-bromophenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 18174190 |
| Molecular Formula | C43H47BrN2O6 |
| Molecular Weight | 767.76 g/mol |
| Exact Mass | 766.26 |
| IUPAC Name | N-(4-bromophenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
| SMILES | COc1cc(-c2cccc(CN3CCC(N(Cc4cccc(-c5cc(OC)c(OC)c(OC)c5)c4)c4ccc(Br)cc4)CC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C43H47BrN2O6/c1-47-38-23-33(24-39(48-2)42(38)51-5)31-11-7-9-29(21-31)27-45-19-17-37(18-20-45)46(36-15-13-35(44)14-16-36)28-30-10-8-12-32(22-30)34-25-40(49-3)43(52-6)41(26-34)50-4/h7-16,21-26,37H,17-20,27-28H2,1-6H3 |
| InChIKey | OMGZNOPMVAADMJ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.76 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |