C28H28FNO3S — CID 142819089
(2R,3S)-3-cyclohepta-1,3,5,6-tetraen-1-yl-5-fluoro-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-7-ol (PubChem CID 142819089) has the molecular formula C28H28FNO3S and a molecular weight of 477.60 g/mol. Its IUPAC name is (2R,3S)-3-cyclohepta-1,3,5,6-tetraen-1-yl-5-fluoro-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-7-ol.
| Compound Name | (2R,3S)-3-cyclohepta-1,3,5,6-tetraen-1-yl-5-fluoro-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 142819089 |
| Molecular Formula | C28H28FNO3S |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (2R,3S)-3-cyclohepta-1,3,5,6-tetraen-1-yl-5-fluoro-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-7-ol |
| SMILES | Oc1cc(F)c2c(c1)O[C@H](c1ccc(OCCN3CCCCC3)cc1)[C@H](C1=CC=CC=C=C1)S2 |
| InChI | InChI=1S/C28H28FNO3S/c29-24-18-22(31)19-25-28(24)34-27(21-8-4-1-2-5-9-21)26(33-25)20-10-12-23(13-11-20)32-17-16-30-14-6-3-7-15-30/h1-2,4,8-13,18-19,26-27,31H,3,6-7,14-17H2/t26-,27+/m1/s1 |
| InChIKey | GKQWJHOUCIYMDV-SXOMAYOGSA-N |
| XLogP | 6.20 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |