C13H13Cl2NO — CID 142826183
4,5-dichloro-1-(1-phenylethyl)-2,3-dihydropyridin-6-one (PubChem CID 142826183) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is 4,5-dichloro-1-(1-phenylethyl)-2,3-dihydropyridin-6-one.
| Compound Name | 4,5-dichloro-1-(1-phenylethyl)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 142826183 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4,5-dichloro-1-(1-phenylethyl)-2,3-dihydropyridin-6-one |
| SMILES | CC(c1ccccc1)N1CCC(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C13H13Cl2NO/c1-9(10-5-3-2-4-6-10)16-8-7-11(14)12(15)13(16)17/h2-6,9H,7-8H2,1H3 |
| InChIKey | RPVDXMXPVLVSIL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |