C19H24N4O3S2 — CID 142827698
N-methylsulfanyl-3-[(8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]aniline (PubChem CID 142827698) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-methylsulfanyl-3-[(8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]aniline.
| Compound Name | N-methylsulfanyl-3-[(8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 142827698 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-methylsulfanyl-3-[(8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]aniline |
| SMILES | CSNc1cccc(S(=O)(=O)N2CCOc3c(N4CCNCC4)cccc32)c1 |
| InChI | InChI=1S/C19H24N4O3S2/c1-27-21-15-4-2-5-16(14-15)28(24,25)23-12-13-26-19-17(6-3-7-18(19)23)22-10-8-20-9-11-22/h2-7,14,20-21H,8-13H2,1H3 |
| InChIKey | LNEFEHKYHCIJTP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|