C50H106N2O2+2 — CID 142827900
ethane;[4-[ethyl(methyl)azaniumyl]-2,3-bis[(Z)-octadec-9-enoxy]butyl]-trimethylazanium (PubChem CID 142827900) has the molecular formula C50H106N2O2+2 and a molecular weight of 767.41 g/mol. Its IUPAC name is ethane;[4-[ethyl(methyl)azaniumyl]-2,3-bis[(Z)-octadec-9-enoxy]butyl]-trimethylazanium.
| Compound Name | ethane;[4-[ethyl(methyl)azaniumyl]-2,3-bis[(Z)-octadec-9-enoxy]butyl]-trimethylazanium |
|---|---|
| PubChem CID | 142827900 |
| Molecular Formula | C50H106N2O2+2 |
| Molecular Weight | 767.41 g/mol |
| Exact Mass | 766.82 |
| IUPAC Name | ethane;[4-[ethyl(methyl)azaniumyl]-2,3-bis[(Z)-octadec-9-enoxy]butyl]-trimethylazanium |
| SMILES | CC.CC.CCCCCCCC/C=C\CCCCCCCCOC(C[NH+](C)CC)C(C[N+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H93N2O2.2C2H6/c1-8-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-49-45(43-47(4)10-3)46(44-48(5,6)7)50-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-9-2;2*1-2/h23-26,45-46H,8-22,27-44H2,1-7H3;2*1-2H3/q+1;;/p+1/b25-23-,26-24-;; |
| InChIKey | SZCPKEPZCRKWAA-BZQROKMSSA-O |
| XLogP | 14.12 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.41 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|