C23H49NO5P+ — CID 54317765
trimethyl-(2-octadec-9-enoxy-2-phosphonooxyethyl)azanium (PubChem CID 54317765) has the molecular formula C23H49NO5P+ and a molecular weight of 450.62 g/mol. Its IUPAC name is trimethyl-(2-octadec-9-enoxy-2-phosphonooxyethyl)azanium.
| Compound Name | trimethyl-(2-octadec-9-enoxy-2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 54317765 |
| Molecular Formula | C23H49NO5P+ |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | trimethyl-(2-octadec-9-enoxy-2-phosphonooxyethyl)azanium |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(C[N+](C)(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C23H48NO5P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28-23(22-24(2,3)4)29-30(25,26)27/h12-13,23H,5-11,14-22H2,1-4H3,(H-,25,26,27)/p+1 |
| InChIKey | SPLJRTRCLKBWIR-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|