C25H37NO3 — CID 142828062
ethane;2-[3-[2-(2-hexan-2-yl-4,6-dioxooxan-2-yl)ethyl]phenyl]-2-methylpropanenitrile (PubChem CID 142828062) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is ethane;2-[3-[2-(2-hexan-2-yl-4,6-dioxooxan-2-yl)ethyl]phenyl]-2-methylpropanenitrile.
| Compound Name | ethane;2-[3-[2-(2-hexan-2-yl-4,6-dioxooxan-2-yl)ethyl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 142828062 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | ethane;2-[3-[2-(2-hexan-2-yl-4,6-dioxooxan-2-yl)ethyl]phenyl]-2-methylpropanenitrile |
| SMILES | CC.CCCCC(C)C1(CCc2cccc(C(C)(C)C#N)c2)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C23H31NO3.C2H6/c1-5-6-8-17(2)23(15-20(25)14-21(26)27-23)12-11-18-9-7-10-19(13-18)22(3,4)16-24;1-2/h7,9-10,13,17H,5-6,8,11-12,14-15H2,1-4H3;1-2H3 |
| InChIKey | AYFWCFLTFKMFIT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|