C10H11NO — CID 142830159
1-amino-6,7-dihydronaphthalen-2-ol (PubChem CID 142830159) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-amino-6,7-dihydronaphthalen-2-ol.
| Compound Name | 1-amino-6,7-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 142830159 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-amino-6,7-dihydronaphthalen-2-ol |
| SMILES | Nc1c(O)ccc2c1=CCCC=2 |
| InChI | InChI=1S/C10H11NO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h3-6,12H,1-2,11H2 |
| InChIKey | BYFIINRPWNCVOM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|