C6H9NO — CID 130196657
2-aminocyclohexa-1,5-dien-1-ol (PubChem CID 130196657) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is 2-aminocyclohexa-1,5-dien-1-ol.
| Compound Name | 2-aminocyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 130196657 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 2-aminocyclohexa-1,5-dien-1-ol |
| SMILES | NC1=C(O)C=CCC1 |
| InChI | InChI=1S/C6H9NO/c7-5-3-1-2-4-6(5)8/h2,4,8H,1,3,7H2 |
| InChIKey | UDXABMXGSWQRLD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |