C13H11F3N2O — CID 142831770
N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide (PubChem CID 142831770) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142831770 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC1=c2ccncc2=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O/c14-13(15,16)12(19)18-8-10-4-2-1-3-9-7-17-6-5-11(9)10/h1-3,5-7H,4,8H2,(H,18,19) |
| InChIKey | URLGOUYVXZRXNH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |