About N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine
N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine (PubChem CID 142832087) has the molecular formula C19H27FN2
and a molecular weight of 302.44 g/mol. Its IUPAC name is N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine |
| PubChem CID | 142832087 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine |
| SMILES | CCNCCc1ccc(F)cc1.NCCCc1ccccc1 |
| InChI | InChI=1S/C10H14FN.C9H13N/c1-2-12-8-7-9-3-5-10(11)6-4-9;10-8-4-7-9-5-2-1-3-6-9/h3-6,12H,2,7-8H2,1H3;1-3,5-6H,4,7-8,10H2 |
| InChIKey | GPEKIDZMKASVGI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine?
The IUPAC name of N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine (CID 142832087) is N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine.
What is the SMILES notation for N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine?
The canonical SMILES for N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine is CCNCCc1ccc(F)cc1.NCCCc1ccccc1.
What is the InChIKey of N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine?
The InChIKey is GPEKIDZMKASVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN.C9H13N/c1-2-12-8-7-9-3-5-10(11)6-4-9;10-8-4-7-9-5-2-1-3-6-9/h3-6,12H,2,7-8H2,1H3;1-3,5-6H,4,7-8,10H2.
What are the key properties of N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine?
N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine has a molecular weight of 302.44 g/mol, XLogP of 3.56, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(4-fluorophenyl)ethanamine;3-phenylpropan-1-amine is sourced from PubChem (CID 142832087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).