C30H52O — CID 142833957
2-[(E)-4-cyclohex-2-en-1-yl-6-methylhept-2-en-2-yl]cyclohexa-1,3-diene;heptane;propan-2-one (PubChem CID 142833957) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is 2-[(E)-4-cyclohex-2-en-1-yl-6-methylhept-2-en-2-yl]cyclohexa-1,3-diene;heptane;propan-2-one.
| Compound Name | 2-[(E)-4-cyclohex-2-en-1-yl-6-methylhept-2-en-2-yl]cyclohexa-1,3-diene;heptane;propan-2-one |
|---|---|
| PubChem CID | 142833957 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | 2-[(E)-4-cyclohex-2-en-1-yl-6-methylhept-2-en-2-yl]cyclohexa-1,3-diene;heptane;propan-2-one |
| SMILES | C/C(=C\C(CC(C)C)C1C=CCCC1)C1=CCCC=C1.CC(C)=O.CCCCCCC |
| InChI | InChI=1S/C20H30.C7H16.C3H6O/c1-16(2)14-20(19-12-8-5-9-13-19)15-17(3)18-10-6-4-7-11-18;1-3-5-7-6-4-2;1-3(2)4/h6,8,10-12,15-16,19-20H,4-5,7,9,13-14H2,1-3H3;3-7H2,1-2H3;1-2H3/b17-15+;; |
| InChIKey | DXCZDSZDNGSNKW-UVVJDXDRSA-N |
| XLogP | 9.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|