C16H18N3O3+ — CID 142835883
[1-(6-amino-3-carboxy-2-methoxyphenyl)-3-pyridin-2-ylpropylidene]azanium (PubChem CID 142835883) has the molecular formula C16H18N3O3+ and a molecular weight of 300.34 g/mol. Its IUPAC name is [1-(6-amino-3-carboxy-2-methoxyphenyl)-3-pyridin-2-ylpropylidene]azanium.
| Compound Name | [1-(6-amino-3-carboxy-2-methoxyphenyl)-3-pyridin-2-ylpropylidene]azanium |
|---|---|
| PubChem CID | 142835883 |
| Molecular Formula | C16H18N3O3+ |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [1-(6-amino-3-carboxy-2-methoxyphenyl)-3-pyridin-2-ylpropylidene]azanium |
| SMILES | COc1c(C(=O)O)ccc(N)c1C(=[NH2+])CCc1ccccn1 |
| InChI | InChI=1S/C16H17N3O3/c1-22-15-11(16(20)21)6-8-13(18)14(15)12(17)7-5-10-4-2-3-9-19-10/h2-4,6,8-9,17H,5,7,18H2,1H3,(H,20,21)/p+1 |
| InChIKey | PEZBTSBEDCVHCH-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|