C16H17N3O3 — CID 142835884
4-amino-2-methoxy-3-(3-pyridin-2-ylpropanimidoyl)benzoic acid (PubChem CID 142835884) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-amino-2-methoxy-3-(3-pyridin-2-ylpropanimidoyl)benzoic acid.
| Compound Name | 4-amino-2-methoxy-3-(3-pyridin-2-ylpropanimidoyl)benzoic acid |
|---|---|
| PubChem CID | 142835884 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-amino-2-methoxy-3-(3-pyridin-2-ylpropanimidoyl)benzoic acid |
| SMILES | [H]/N=C(\CCc1ccccn1)c1c(N)ccc(C(=O)O)c1OC |
| InChI | InChI=1S/C16H17N3O3/c1-22-15-11(16(20)21)6-8-13(18)14(15)12(17)7-5-10-4-2-3-9-19-10/h2-4,6,8-9,17H,5,7,18H2,1H3,(H,20,21)/b17-12+ |
| InChIKey | PEZBTSBEDCVHCH-SFQUDFHCSA-N |
| XLogP | 2.37 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|